Chemistry 331 - Fall 1996

Homework, Chapter 2 - Alkanes


McMurry, pp 65 - 69:

Problems 2.24, 25, 28, 29, 33, 34, 35, 38, 40, 41, 46, 48, 50, 53, 54

1. Each of the names shown below is incorrect. Deduce the compound to which the name refers, and give its correct IUPAC name.

a) 4-methylhexane

b) 2-ethylpropane

c) 1,1,2-trimethylbutane

d) isopropylethane

e) 2-chloro-2-ethylpentane

2. Give complete IUPAC names for each of the following compounds:

a) CH3-CHCl-CH2-C(CH3)2-CBrCl-CH-C(CH3)3

CH2-CH2-CHCl-CH3

b) Cl3C-CH2-CHF-C(CH3)-CCl3

CH2-CH(CH3)2

3. Write out structural formulas for all of the isomers that have the molecular formulas shown below. Identify each of the functional groups present, but you need not name any of the compounds.

a) C3H6Cl2

b) C3H6O

c) C2H3N